C25H57N3O5PS+ — CID 88673981
1-hexadecyl-1-(2-hydroxyethyl)-3-methylthiourea;trimethyl(2-phosphonooxyethyl)azanium (PubChem CID 88673981) has the molecular formula C25H57N3O5PS+ and a molecular weight of 542.79 g/mol. Its IUPAC name is 1-hexadecyl-1-(2-hydroxyethyl)-3-methylthiourea;trimethyl(2-phosphonooxyethyl)azanium.
| Compound Name | 1-hexadecyl-1-(2-hydroxyethyl)-3-methylthiourea;trimethyl(2-phosphonooxyethyl)azanium |
|---|---|
| PubChem CID | 88673981 |
| Molecular Formula | C25H57N3O5PS+ |
| Molecular Weight | 542.79 g/mol |
| Exact Mass | 542.38 |
| IUPAC Name | 1-hexadecyl-1-(2-hydroxyethyl)-3-methylthiourea;trimethyl(2-phosphonooxyethyl)azanium |
| SMILES | CCCCCCCCCCCCCCCCN(CCO)C(=S)NC.C[N+](C)(C)CCOP(=O)(O)O |
| InChI | InChI=1S/C20H42N2OS.C5H14NO4P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(18-19-23)20(24)21-2;1-6(2,3)4-5-10-11(7,8)9/h23H,3-19H2,1-2H3,(H,21,24);4-5H2,1-3H3,(H-,7,8,9)/p+1 |
| InChIKey | APNDJWFVSGXLJX-UHFFFAOYSA-O |
| XLogP | 5.07 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.79 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|