C7H21NO6P+ — CID 87302200
ethane-1,2-diol;trimethyl(2-phosphonooxyethyl)azanium (PubChem CID 87302200) has the molecular formula C7H21NO6P+ and a molecular weight of 246.22 g/mol. Its IUPAC name is ethane-1,2-diol;trimethyl(2-phosphonooxyethyl)azanium.
| Compound Name | ethane-1,2-diol;trimethyl(2-phosphonooxyethyl)azanium |
|---|---|
| PubChem CID | 87302200 |
| Molecular Formula | C7H21NO6P+ |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | ethane-1,2-diol;trimethyl(2-phosphonooxyethyl)azanium |
| SMILES | C[N+](C)(C)CCOP(=O)(O)O.OCCO |
| InChI | InChI=1S/C5H14NO4P.C2H6O2/c1-6(2,3)4-5-10-11(7,8)9;3-1-2-4/h4-5H2,1-3H3,(H-,7,8,9);3-4H,1-2H2/p+1 |
| InChIKey | KZWGDEKBNPNKAJ-UHFFFAOYSA-O |
| XLogP | -1.23 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|