2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate

C5H16NO5P — CID 90410935

IUPAC2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate
SMILESC[N+](C)(C)CCOP(=O)([O-])O.O
InChIInChI=1S/C5H14NO4P.H2O/c1-6(2,3)4-5-10-11(7,8)9;/h4-5H2,1-3H3,(H-,7,8,9);1H2
InChIKeyUFVVUSUCUYHXSZ-UHFFFAOYSA-N
MW201.16 g/mol
LogP-1.65
Rot. Bonds4

About 2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate

2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate (PubChem CID 90410935) has the molecular formula C5H16NO5P and a molecular weight of 201.16 g/mol. Its IUPAC name is 2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate.

Molecular Properties

Compound Name2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate
PubChem CID90410935
Molecular FormulaC5H16NO5P
Molecular Weight201.16 g/mol
Exact Mass201.08
IUPAC Name2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate
SMILESC[N+](C)(C)CCOP(=O)([O-])O.O
InChIInChI=1S/C5H14NO4P.H2O/c1-6(2,3)4-5-10-11(7,8)9;/h4-5H2,1-3H3,(H-,7,8,9);1H2
InChIKeyUFVVUSUCUYHXSZ-UHFFFAOYSA-N
XLogP-1.65
TPSA101.09 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.16
LogP ≤ 5-1.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze 2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate?
The IUPAC name of 2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate (CID 90410935) is 2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate.
What is the SMILES notation for 2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate?
The canonical SMILES for 2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate is C[N+](C)(C)CCOP(=O)([O-])O.O.
What is the InChIKey of 2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate?
The InChIKey is UFVVUSUCUYHXSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14NO4P.H2O/c1-6(2,3)4-5-10-11(7,8)9;/h4-5H2,1-3H3,(H-,7,8,9);1H2.
What are the key properties of 2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate?
2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate has a molecular weight of 201.16 g/mol, XLogP of -1.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate is sourced from PubChem (CID 90410935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).