C5H16NO5P — CID 90410935
2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate (PubChem CID 90410935) has the molecular formula C5H16NO5P and a molecular weight of 201.16 g/mol. Its IUPAC name is 2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate.
| Compound Name | 2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate |
|---|---|
| PubChem CID | 90410935 |
| Molecular Formula | C5H16NO5P |
| Molecular Weight | 201.16 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 2-(trimethylazaniumyl)ethyl hydrogen phosphate;hydrate |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])O.O |
| InChI | InChI=1S/C5H14NO4P.H2O/c1-6(2,3)4-5-10-11(7,8)9;/h4-5H2,1-3H3,(H-,7,8,9);1H2 |
| InChIKey | UFVVUSUCUYHXSZ-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 101.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.16 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|