C11H22NO8P — CID 67223446
3,6-dimethyl-1,4-dioxane-2,5-dione;2-(trimethylazaniumyl)ethyl hydrogen phosphate (PubChem CID 67223446) has the molecular formula C11H22NO8P and a molecular weight of 327.27 g/mol. Its IUPAC name is 3,6-dimethyl-1,4-dioxane-2,5-dione;2-(trimethylazaniumyl)ethyl hydrogen phosphate.
| Compound Name | 3,6-dimethyl-1,4-dioxane-2,5-dione;2-(trimethylazaniumyl)ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 67223446 |
| Molecular Formula | C11H22NO8P |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 3,6-dimethyl-1,4-dioxane-2,5-dione;2-(trimethylazaniumyl)ethyl hydrogen phosphate |
| SMILES | CC1OC(=O)C(C)OC1=O.C[N+](C)(C)CCOP(=O)([O-])O |
| InChI | InChI=1S/C6H8O4.C5H14NO4P/c1-3-5(7)10-4(2)6(8)9-3;1-6(2,3)4-5-10-11(7,8)9/h3-4H,1-2H3;4-5H2,1-3H3,(H-,7,8,9) |
| InChIKey | ZLOOTDLSTMUOEG-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|