C12H16O8 — CID 156591924
3,6-dimethyl-1,4-dioxane-2,5-dione;(3S,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione (PubChem CID 156591924) has the molecular formula C12H16O8 and a molecular weight of 288.25 g/mol. Its IUPAC name is 3,6-dimethyl-1,4-dioxane-2,5-dione;(3S,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione.
| Compound Name | 3,6-dimethyl-1,4-dioxane-2,5-dione;(3S,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione |
|---|---|
| PubChem CID | 156591924 |
| Molecular Formula | C12H16O8 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3,6-dimethyl-1,4-dioxane-2,5-dione;(3S,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione |
| SMILES | CC1OC(=O)C(C)OC1=O.C[C@@H]1OC(=O)[C@H](C)OC1=O |
| InChI | InChI=1S/2C6H8O4/c2*1-3-5(7)10-4(2)6(8)9-3/h2*3-4H,1-2H3/t3-,4-;/m0./s1 |
| InChIKey | JFPPGQABHIMQKV-MMALYQPHSA-N |
| XLogP | -0.27 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|