C8H12O5 — CID 87489456
3,6-dimethyl-1,4-dioxane-2,5-dione;oxirane (PubChem CID 87489456) has the molecular formula C8H12O5 and a molecular weight of 188.18 g/mol. Its IUPAC name is 3,6-dimethyl-1,4-dioxane-2,5-dione;oxirane.
| Compound Name | 3,6-dimethyl-1,4-dioxane-2,5-dione;oxirane |
|---|---|
| PubChem CID | 87489456 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 3,6-dimethyl-1,4-dioxane-2,5-dione;oxirane |
| SMILES | C1CO1.CC1OC(=O)C(C)OC1=O |
| InChI | InChI=1S/C6H8O4.C2H4O/c1-3-5(7)10-4(2)6(8)9-3;1-2-3-1/h3-4H,1-2H3;1-2H2 |
| InChIKey | XXZFYZZGGOPZIA-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|