C12H12O4 — CID 23504963
3-benzyl-6-methyl-1,4-dioxane-2,5-dione (PubChem CID 23504963) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is 3-benzyl-6-methyl-1,4-dioxane-2,5-dione.
| Compound Name | 3-benzyl-6-methyl-1,4-dioxane-2,5-dione |
|---|---|
| PubChem CID | 23504963 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 3-benzyl-6-methyl-1,4-dioxane-2,5-dione |
| SMILES | CC1OC(=O)C(Cc2ccccc2)OC1=O |
| InChI | InChI=1S/C12H12O4/c1-8-11(13)16-10(12(14)15-8)7-9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3 |
| InChIKey | DFYKCOWGIBSJOD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |