C13H14O5 — CID 59819056
(6S)-3-methyl-6-(phenylmethoxymethyl)-1,4-dioxane-2,5-dione (PubChem CID 59819056) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is (6S)-3-methyl-6-(phenylmethoxymethyl)-1,4-dioxane-2,5-dione.
| Compound Name | (6S)-3-methyl-6-(phenylmethoxymethyl)-1,4-dioxane-2,5-dione |
|---|---|
| PubChem CID | 59819056 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (6S)-3-methyl-6-(phenylmethoxymethyl)-1,4-dioxane-2,5-dione |
| SMILES | CC1OC(=O)[C@H](COCc2ccccc2)OC1=O |
| InChI | InChI=1S/C13H14O5/c1-9-12(14)18-11(13(15)17-9)8-16-7-10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3/t9?,11-/m0/s1 |
| InChIKey | BJUHVQXYPKQGSY-UMJHXOGRSA-N |
| XLogP | 1.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |