C14H16O5 — CID 71242586
3-ethyl-6-(phenylmethoxymethyl)-1,4-dioxane-2,5-dione (PubChem CID 71242586) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is 3-ethyl-6-(phenylmethoxymethyl)-1,4-dioxane-2,5-dione.
| Compound Name | 3-ethyl-6-(phenylmethoxymethyl)-1,4-dioxane-2,5-dione |
|---|---|
| PubChem CID | 71242586 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3-ethyl-6-(phenylmethoxymethyl)-1,4-dioxane-2,5-dione |
| SMILES | CCC1OC(=O)C(COCc2ccccc2)OC1=O |
| InChI | InChI=1S/C14H16O5/c1-2-11-13(15)19-12(14(16)18-11)9-17-8-10-6-4-3-5-7-10/h3-7,11-12H,2,8-9H2,1H3 |
| InChIKey | UPQFGDKAJATWLU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |