C12H14O3 — CID 134988868
(3R,4S)-3-methyl-4-(phenylmethoxymethyl)oxetan-2-one (PubChem CID 134988868) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (3R,4S)-3-methyl-4-(phenylmethoxymethyl)oxetan-2-one.
| Compound Name | (3R,4S)-3-methyl-4-(phenylmethoxymethyl)oxetan-2-one |
|---|---|
| PubChem CID | 134988868 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (3R,4S)-3-methyl-4-(phenylmethoxymethyl)oxetan-2-one |
| SMILES | C[C@H]1C(=O)O[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C12H14O3/c1-9-11(15-12(9)13)8-14-7-10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3/t9-,11-/m1/s1 |
| InChIKey | KVXZWSNOVZVLSE-MWLCHTKSSA-N |
| XLogP | 1.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|