C14H18O3 — CID 166718283
(3R,4S,5S)-3,4-dimethyl-5-(phenylmethoxymethyl)oxolan-2-one (PubChem CID 166718283) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (3R,4S,5S)-3,4-dimethyl-5-(phenylmethoxymethyl)oxolan-2-one.
| Compound Name | (3R,4S,5S)-3,4-dimethyl-5-(phenylmethoxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 166718283 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (3R,4S,5S)-3,4-dimethyl-5-(phenylmethoxymethyl)oxolan-2-one |
| SMILES | C[C@@H]1[C@@H](COCc2ccccc2)OC(=O)[C@@H]1C |
| InChI | InChI=1S/C14H18O3/c1-10-11(2)14(15)17-13(10)9-16-8-12-6-4-3-5-7-12/h3-7,10-11,13H,8-9H2,1-2H3/t10-,11+,13+/m0/s1 |
| InChIKey | WDERBBZHOAKVAD-DMDPSCGWSA-N |
| XLogP | 2.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |