C19H18O5 — CID 129385478
(2R,3aR,6R,6aR)-2-phenyl-6-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one (PubChem CID 129385478) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is (2R,3aR,6R,6aR)-2-phenyl-6-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one.
| Compound Name | (2R,3aR,6R,6aR)-2-phenyl-6-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 129385478 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (2R,3aR,6R,6aR)-2-phenyl-6-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
| SMILES | O=C1O[C@H](COCc2ccccc2)[C@H]2O[C@@H](c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C19H18O5/c20-18-17-16(23-19(24-17)14-9-5-2-6-10-14)15(22-18)12-21-11-13-7-3-1-4-8-13/h1-10,15-17,19H,11-12H2/t15-,16-,17-,19-/m1/s1 |
| InChIKey | GERKBPQOPJOOHJ-YWTNHNAXSA-N |
| XLogP | 2.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |