C5H16NO7P2+ — CID 13292816
2-[hydroxy(phosphonooxy)phosphoryl]oxyethyl-trimethylazanium (PubChem CID 13292816) has the molecular formula C5H16NO7P2+ and a molecular weight of 264.13 g/mol. Its IUPAC name is 2-[hydroxy(phosphonooxy)phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy(phosphonooxy)phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 13292816 |
| Molecular Formula | C5H16NO7P2+ |
| Molecular Weight | 264.13 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 2-[hydroxy(phosphonooxy)phosphoryl]oxyethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C5H15NO7P2/c1-6(2,3)4-5-12-15(10,11)13-14(7,8)9/h4-5H2,1-3H3,(H2-,7,8,9,10,11)/p+1 |
| InChIKey | ADIFCEAGUXFWKQ-UHFFFAOYSA-O |
| XLogP | -0.08 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.13 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|