C8H20N2O4P+ — CID 87501398
2-[hydroxy-(prop-2-enylamino)oxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 87501398) has the molecular formula C8H20N2O4P+ and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-[hydroxy-(prop-2-enylamino)oxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-(prop-2-enylamino)oxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 87501398 |
| Molecular Formula | C8H20N2O4P+ |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 2-[hydroxy-(prop-2-enylamino)oxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | C=CCNOP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C8H19N2O4P/c1-5-6-9-14-15(11,12)13-8-7-10(2,3)4/h5,9H,1,6-8H2,2-4H3/p+1 |
| InChIKey | XWVPXKDTFWEBRK-UHFFFAOYSA-O |
| XLogP | 0.52 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|