C11H25NO6P+ — CID 87400762
2-[hydroxy-[(2S)-1-hydroxy-3-prop-2-enoxypropan-2-yl]oxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 87400762) has the molecular formula C11H25NO6P+ and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-[hydroxy-[(2S)-1-hydroxy-3-prop-2-enoxypropan-2-yl]oxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2S)-1-hydroxy-3-prop-2-enoxypropan-2-yl]oxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 87400762 |
| Molecular Formula | C11H25NO6P+ |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-[hydroxy-[(2S)-1-hydroxy-3-prop-2-enoxypropan-2-yl]oxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | C=CCOC[C@H](CO)OP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C11H24NO6P/c1-5-7-16-10-11(9-13)18-19(14,15)17-8-6-12(2,3)4/h5,11,13H,1,6-10H2,2-4H3/p+1/t11-/m0/s1 |
| InChIKey | IKPLDTFJUNXSJM-NSHDSACASA-O |
| XLogP | 0.39 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|