C20H46N2O5P+ — CID 23313112
2-[[1-decoxy-3-(ethylamino)propan-2-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 23313112) has the molecular formula C20H46N2O5P+ and a molecular weight of 425.57 g/mol. Its IUPAC name is 2-[[1-decoxy-3-(ethylamino)propan-2-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[1-decoxy-3-(ethylamino)propan-2-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 23313112 |
| Molecular Formula | C20H46N2O5P+ |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.31 |
| IUPAC Name | 2-[[1-decoxy-3-(ethylamino)propan-2-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCCCCOCC(CNCC)OP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C20H45N2O5P/c1-6-8-9-10-11-12-13-14-16-25-19-20(18-21-7-2)27-28(23,24)26-17-15-22(3,4)5/h20-21H,6-19H2,1-5H3/p+1 |
| InChIKey | MNFJSJHCMGBQBE-UHFFFAOYSA-O |
| XLogP | 3.96 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|