C14H29NO8P+ — CID 59153667
2-[hydroxy-[1-(2-methoxyethoxy)-3-prop-2-enoyloxypropan-2-yl]oxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 59153667) has the molecular formula C14H29NO8P+ and a molecular weight of 370.36 g/mol. Its IUPAC name is 2-[hydroxy-[1-(2-methoxyethoxy)-3-prop-2-enoyloxypropan-2-yl]oxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[1-(2-methoxyethoxy)-3-prop-2-enoyloxypropan-2-yl]oxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 59153667 |
| Molecular Formula | C14H29NO8P+ |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-[hydroxy-[1-(2-methoxyethoxy)-3-prop-2-enoyloxypropan-2-yl]oxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | C=CC(=O)OCC(COCCOC)OP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C14H28NO8P/c1-6-14(16)21-12-13(11-20-10-9-19-5)23-24(17,18)22-8-7-15(2,3)4/h6,13H,1,7-12H2,2-5H3/p+1 |
| InChIKey | UMEROCJFUVETSY-UHFFFAOYSA-O |
| XLogP | 0.59 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|