C12H27NO7P+ — CID 175228586
ethyl dihydrogen phosphate;trimethyl-[2-(2-prop-2-enoyloxyethoxy)ethyl]azanium (PubChem CID 175228586) has the molecular formula C12H27NO7P+ and a molecular weight of 328.32 g/mol. Its IUPAC name is ethyl dihydrogen phosphate;trimethyl-[2-(2-prop-2-enoyloxyethoxy)ethyl]azanium.
| Compound Name | ethyl dihydrogen phosphate;trimethyl-[2-(2-prop-2-enoyloxyethoxy)ethyl]azanium |
|---|---|
| PubChem CID | 175228586 |
| Molecular Formula | C12H27NO7P+ |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | ethyl dihydrogen phosphate;trimethyl-[2-(2-prop-2-enoyloxyethoxy)ethyl]azanium |
| SMILES | C=CC(=O)OCCOCC[N+](C)(C)C.CCOP(=O)(O)O |
| InChI | InChI=1S/C10H20NO3.C2H7O4P/c1-5-10(12)14-9-8-13-7-6-11(2,3)4;1-2-6-7(3,4)5/h5H,1,6-9H2,2-4H3;2H2,1H3,(H2,3,4,5)/q+1; |
| InChIKey | GYGOBUORQFSRIQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|