sulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium

C8H18NO6S+ — CID 87436586

IUPACsulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium
SMILESC=CC(=O)OCC[N+](C)(C)C.O=S(=O)(O)O
InChIInChI=1S/C8H16NO2.H2O4S/c1-5-8(10)11-7-6-9(2,3)4;1-5(2,3)4/h5H,1,6-7H2,2-4H3;(H2,1,2,3,4)/q+1;
InChIKeyCWTYJHNHZFOHFY-UHFFFAOYSA-N
MW256.30 g/mol
LogP-0.23
Rot. Bonds4

About sulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium

sulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium (PubChem CID 87436586) has the molecular formula C8H18NO6S+ and a molecular weight of 256.30 g/mol. Its IUPAC name is sulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium.

Molecular Properties

Compound Namesulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium
PubChem CID87436586
Molecular FormulaC8H18NO6S+
Molecular Weight256.30 g/mol
Exact Mass256.08
IUPAC Namesulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium
SMILESC=CC(=O)OCC[N+](C)(C)C.O=S(=O)(O)O
InChIInChI=1S/C8H16NO2.H2O4S/c1-5-8(10)11-7-6-9(2,3)4;1-5(2,3)4/h5H,1,6-7H2,2-4H3;(H2,1,2,3,4)/q+1;
InChIKeyCWTYJHNHZFOHFY-UHFFFAOYSA-N
XLogP-0.23
TPSA100.90 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.30
LogP ≤ 5-0.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium?
The IUPAC name of sulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium (CID 87436586) is sulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium.
What is the SMILES notation for sulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium?
The canonical SMILES for sulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium is C=CC(=O)OCC[N+](C)(C)C.O=S(=O)(O)O.
What is the InChIKey of sulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium?
The InChIKey is CWTYJHNHZFOHFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16NO2.H2O4S/c1-5-8(10)11-7-6-9(2,3)4;1-5(2,3)4/h5H,1,6-7H2,2-4H3;(H2,1,2,3,4)/q+1;.
What are the key properties of sulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium?
sulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium has a molecular weight of 256.30 g/mol, XLogP of -0.23, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium is sourced from PubChem (CID 87436586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).