C8H18NO6S+ — CID 87436586
sulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium (PubChem CID 87436586) has the molecular formula C8H18NO6S+ and a molecular weight of 256.30 g/mol. Its IUPAC name is sulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium.
| Compound Name | sulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium |
|---|---|
| PubChem CID | 87436586 |
| Molecular Formula | C8H18NO6S+ |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | sulfuric acid;trimethyl(2-prop-2-enoyloxyethyl)azanium |
| SMILES | C=CC(=O)OCC[N+](C)(C)C.O=S(=O)(O)O |
| InChI | InChI=1S/C8H16NO2.H2O4S/c1-5-8(10)11-7-6-9(2,3)4;1-5(2,3)4/h5H,1,6-7H2,2-4H3;(H2,1,2,3,4)/q+1; |
| InChIKey | CWTYJHNHZFOHFY-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|