C17H27NO5S — CID 172711616
4-methylbenzenesulfonate;trimethyl(4-prop-2-enoyloxybutyl)azanium (PubChem CID 172711616) has the molecular formula C17H27NO5S and a molecular weight of 357.47 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;trimethyl(4-prop-2-enoyloxybutyl)azanium.
| Compound Name | 4-methylbenzenesulfonate;trimethyl(4-prop-2-enoyloxybutyl)azanium |
|---|---|
| PubChem CID | 172711616 |
| Molecular Formula | C17H27NO5S |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 4-methylbenzenesulfonate;trimethyl(4-prop-2-enoyloxybutyl)azanium |
| SMILES | C=CC(=O)OCCCC[N+](C)(C)C.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C10H20NO2.C7H8O3S/c1-5-10(12)13-9-7-6-8-11(2,3)4;1-6-2-4-7(5-3-6)11(8,9)10/h5H,1,6-9H2,2-4H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | FIAPEOKVYXCFRM-UHFFFAOYSA-M |
| XLogP | 2.10 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|