C14H25N3O4S — CID 13379057
4-methylbenzenesulfonate;trimethyl-[2-(methylcarbamoylamino)ethyl]azanium (PubChem CID 13379057) has the molecular formula C14H25N3O4S and a molecular weight of 331.44 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;trimethyl-[2-(methylcarbamoylamino)ethyl]azanium.
| Compound Name | 4-methylbenzenesulfonate;trimethyl-[2-(methylcarbamoylamino)ethyl]azanium |
|---|---|
| PubChem CID | 13379057 |
| Molecular Formula | C14H25N3O4S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 4-methylbenzenesulfonate;trimethyl-[2-(methylcarbamoylamino)ethyl]azanium |
| SMILES | CNC(=O)NCC[N+](C)(C)C.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H17N3O.C7H8O3S/c1-8-7(11)9-5-6-10(2,3)4;1-6-2-4-7(5-3-6)11(8,9)10/h5-6H2,1-4H3,(H-,8,9,11);2-5H,1H3,(H,8,9,10) |
| InChIKey | NTJUIEPKXMBBLZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|