C28H48N4O6S2 — CID 135395378
bis(4-methylbenzenesulfonate);trimethyl-[2-[4-[2-(trimethylazaniumyl)ethyl]piperazin-1-yl]ethyl]azanium (PubChem CID 135395378) has the molecular formula C28H48N4O6S2 and a molecular weight of 600.85 g/mol. Its IUPAC name is bis(4-methylbenzenesulfonate);trimethyl-[2-[4-[2-(trimethylazaniumyl)ethyl]piperazin-1-yl]ethyl]azanium.
| Compound Name | bis(4-methylbenzenesulfonate);trimethyl-[2-[4-[2-(trimethylazaniumyl)ethyl]piperazin-1-yl]ethyl]azanium |
|---|---|
| PubChem CID | 135395378 |
| Molecular Formula | C28H48N4O6S2 |
| Molecular Weight | 600.85 g/mol |
| Exact Mass | 600.30 |
| IUPAC Name | bis(4-methylbenzenesulfonate);trimethyl-[2-[4-[2-(trimethylazaniumyl)ethyl]piperazin-1-yl]ethyl]azanium |
| SMILES | C[N+](C)(C)CCN1CCN(CC[N+](C)(C)C)CC1.Cc1ccc(S(=O)(=O)[O-])cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C14H34N4.2C7H8O3S/c1-17(2,3)13-11-15-7-9-16(10-8-15)12-14-18(4,5)6;2*1-6-2-4-7(5-3-6)11(8,9)10/h7-14H2,1-6H3;2*2-5H,1H3,(H,8,9,10)/q+2;;/p-2 |
| InChIKey | BLIJXZQOLZPRMG-UHFFFAOYSA-L |
| XLogP | 1.81 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.85 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|