C16H25NO5S — CID 141312727
4-carboxypent-3-enyl(trimethyl)azanium;4-methylbenzenesulfonate (PubChem CID 141312727) has the molecular formula C16H25NO5S and a molecular weight of 343.45 g/mol. Its IUPAC name is 4-carboxypent-3-enyl(trimethyl)azanium;4-methylbenzenesulfonate.
| Compound Name | 4-carboxypent-3-enyl(trimethyl)azanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 141312727 |
| Molecular Formula | C16H25NO5S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 4-carboxypent-3-enyl(trimethyl)azanium;4-methylbenzenesulfonate |
| SMILES | CC(=CCC[N+](C)(C)C)C(=O)O.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C9H17NO2.C7H8O3S/c1-8(9(11)12)6-5-7-10(2,3)4;1-6-2-4-7(5-3-6)11(8,9)10/h6H,5,7H2,1-4H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | ITAAQEMFEIGKKX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|