C10H21NO6S — CID 141312726
4-carboxypent-3-enyl(trimethyl)azanium;methyl sulfate (PubChem CID 141312726) has the molecular formula C10H21NO6S and a molecular weight of 283.35 g/mol. Its IUPAC name is 4-carboxypent-3-enyl(trimethyl)azanium;methyl sulfate.
| Compound Name | 4-carboxypent-3-enyl(trimethyl)azanium;methyl sulfate |
|---|---|
| PubChem CID | 141312726 |
| Molecular Formula | C10H21NO6S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 4-carboxypent-3-enyl(trimethyl)azanium;methyl sulfate |
| SMILES | CC(=CCC[N+](C)(C)C)C(=O)O.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H17NO2.CH4O4S/c1-8(9(11)12)6-5-7-10(2,3)4;1-5-6(2,3)4/h6H,5,7H2,1-4H3;1H3,(H,2,3,4) |
| InChIKey | ZHIATNJSDVTQBO-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|