C7H17NO7S — CID 87326641
carboxy-ethyl-(2-hydroxyethyl)-methylazanium;methyl sulfate (PubChem CID 87326641) has the molecular formula C7H17NO7S and a molecular weight of 259.28 g/mol. Its IUPAC name is carboxy-ethyl-(2-hydroxyethyl)-methylazanium;methyl sulfate.
| Compound Name | carboxy-ethyl-(2-hydroxyethyl)-methylazanium;methyl sulfate |
|---|---|
| PubChem CID | 87326641 |
| Molecular Formula | C7H17NO7S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | carboxy-ethyl-(2-hydroxyethyl)-methylazanium;methyl sulfate |
| SMILES | CC[N+](C)(CCO)C(=O)O.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C6H13NO3.CH4O4S/c1-3-7(2,4-5-8)6(9)10;1-5-6(2,3)4/h8H,3-5H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | MDMNIICGHATLDN-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|