C11H27NO5S — CID 174657208
ethyl-(2-hydroxyethyl)-methyl-pentylazanium;methyl sulfate (PubChem CID 174657208) has the molecular formula C11H27NO5S and a molecular weight of 285.41 g/mol. Its IUPAC name is ethyl-(2-hydroxyethyl)-methyl-pentylazanium;methyl sulfate.
| Compound Name | ethyl-(2-hydroxyethyl)-methyl-pentylazanium;methyl sulfate |
|---|---|
| PubChem CID | 174657208 |
| Molecular Formula | C11H27NO5S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | ethyl-(2-hydroxyethyl)-methyl-pentylazanium;methyl sulfate |
| SMILES | CCCCC[N+](C)(CC)CCO.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C10H24NO.CH4O4S/c1-4-6-7-8-11(3,5-2)9-10-12;1-5-6(2,3)4/h12H,4-10H2,1-3H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | MSDQLLAZBMEDGT-UHFFFAOYSA-M |
| XLogP | 0.73 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|