C46H96N2O8S — CID 139902801
bis(bis(2-hydroxyethyl)-methyl-[(Z)-octadec-9-enyl]azanium);sulfate (PubChem CID 139902801) has the molecular formula C46H96N2O8S and a molecular weight of 837.35 g/mol. Its IUPAC name is bis(bis(2-hydroxyethyl)-methyl-[(Z)-octadec-9-enyl]azanium);sulfate.
| Compound Name | bis(bis(2-hydroxyethyl)-methyl-[(Z)-octadec-9-enyl]azanium);sulfate |
|---|---|
| PubChem CID | 139902801 |
| Molecular Formula | C46H96N2O8S |
| Molecular Weight | 837.35 g/mol |
| Exact Mass | 836.69 |
| IUPAC Name | bis(bis(2-hydroxyethyl)-methyl-[(Z)-octadec-9-enyl]azanium);sulfate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC[N+](C)(CCO)CCO.CCCCCCCC/C=C\CCCCCCCC[N+](C)(CCO)CCO.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C23H48NO2.H2O4S/c2*1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(2,20-22-25)21-23-26;1-5(2,3)4/h2*10-11,25-26H,3-9,12-23H2,1-2H3;(H2,1,2,3,4)/q2*+1;/p-2/b2*11-10-; |
| InChIKey | OREUPZWKOQLIPT-DEZACRSWSA-L |
| XLogP | 9.57 |
| TPSA | 161.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.35 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|