C90H172N2O14S — CID 175822559
bis(bis[(Z)-2-carboxyicos-11-enyl]-(2-hydroxyethyl)-methylazanium);sulfate (PubChem CID 175822559) has the molecular formula C90H172N2O14S and a molecular weight of 1538.43 g/mol. Its IUPAC name is bis(bis[(Z)-2-carboxyicos-11-enyl]-(2-hydroxyethyl)-methylazanium);sulfate.
| Compound Name | bis(bis[(Z)-2-carboxyicos-11-enyl]-(2-hydroxyethyl)-methylazanium);sulfate |
|---|---|
| PubChem CID | 175822559 |
| Molecular Formula | C90H172N2O14S |
| Molecular Weight | 1538.43 g/mol |
| Exact Mass | 1537.25 |
| IUPAC Name | bis(bis[(Z)-2-carboxyicos-11-enyl]-(2-hydroxyethyl)-methylazanium);sulfate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(C[N+](C)(CCO)CC(CCCCCCCC/C=C\CCCCCCCC)C(=O)O)C(=O)O.CCCCCCCC/C=C\CCCCCCCCC(C[N+](C)(CCO)CC(CCCCCCCC/C=C\CCCCCCCC)C(=O)O)C(=O)O.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C45H85NO5.H2O4S/c2*1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-42(44(48)49)40-46(3,38-39-47)41-43(45(50)51)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2;1-5(2,3)4/h2*18-21,42-43,47H,4-17,22-41H2,1-3H3,(H-,48,49,50,51);(H2,1,2,3,4)/b2*20-18-,21-19-; |
| InChIKey | QNLDXZIPFQDGLG-INCHLEDESA-N |
| XLogP | 24.03 |
| TPSA | 269.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 80 |
| Heavy Atoms | 107 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1538.43 |
| LogP ≤ 5 | 24.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|