About 2-ethylhexanoic acid;octadec-9-en-1-ol
2-ethylhexanoic acid;octadec-9-en-1-ol (PubChem CID 173316349) has the molecular formula C26H52O3
and a molecular weight of 412.70 g/mol. Its IUPAC name is 2-ethylhexanoic acid;octadec-9-en-1-ol.
Molecular Properties
| Compound Name | 2-ethylhexanoic acid;octadec-9-en-1-ol |
| PubChem CID | 173316349 |
| Molecular Formula | C26H52O3 |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 412.39 |
| IUPAC Name | 2-ethylhexanoic acid;octadec-9-en-1-ol |
| SMILES | CCCCC(CC)C(=O)O.CCCCCCCCC=CCCCCCCCCO |
| InChI | InChI=1S/C18H36O.C8H16O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-3-5-6-7(4-2)8(9)10/h9-10,19H,2-8,11-18H2,1H3;7H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | BTMPOISQWFRWHT-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexanoic acid;octadec-9-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexanoic acid;octadec-9-en-1-ol?
The IUPAC name of 2-ethylhexanoic acid;octadec-9-en-1-ol (CID 173316349) is 2-ethylhexanoic acid;octadec-9-en-1-ol.
What is the SMILES notation for 2-ethylhexanoic acid;octadec-9-en-1-ol?
The canonical SMILES for 2-ethylhexanoic acid;octadec-9-en-1-ol is CCCCC(CC)C(=O)O.CCCCCCCCC=CCCCCCCCCO.
What is the InChIKey of 2-ethylhexanoic acid;octadec-9-en-1-ol?
The InChIKey is BTMPOISQWFRWHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O.C8H16O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-3-5-6-7(4-2)8(9)10/h9-10,19H,2-8,11-18H2,1H3;7H,3-6H2,1-2H3,(H,9,10).
What are the key properties of 2-ethylhexanoic acid;octadec-9-en-1-ol?
2-ethylhexanoic acid;octadec-9-en-1-ol has a molecular weight of 412.70 g/mol, XLogP of 8.30, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexanoic acid;octadec-9-en-1-ol is sourced from PubChem (CID 173316349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).