C24H51NO5S — CID 139978483
3-hydroxypropyl-dimethyl-[(Z)-octadec-9-enyl]azanium;methyl sulfate (PubChem CID 139978483) has the molecular formula C24H51NO5S and a molecular weight of 465.74 g/mol. Its IUPAC name is 3-hydroxypropyl-dimethyl-[(Z)-octadec-9-enyl]azanium;methyl sulfate.
| Compound Name | 3-hydroxypropyl-dimethyl-[(Z)-octadec-9-enyl]azanium;methyl sulfate |
|---|---|
| PubChem CID | 139978483 |
| Molecular Formula | C24H51NO5S |
| Molecular Weight | 465.74 g/mol |
| Exact Mass | 465.35 |
| IUPAC Name | 3-hydroxypropyl-dimethyl-[(Z)-octadec-9-enyl]azanium;methyl sulfate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC[N+](C)(C)CCCO.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C23H48NO.CH4O4S/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21-24(2,3)22-20-23-25;1-5-6(2,3)4/h11-12,25H,4-10,13-23H2,1-3H3;1H3,(H,2,3,4)/q+1;/p-1/b12-11-; |
| InChIKey | IANPANDYCQCHOD-AFEZEDKISA-M |
| XLogP | 5.58 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.74 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|