C39H79NO4S — CID 87485636
dimethyl-bis[(Z)-octadec-9-enyl]azanium;methyl sulfate (PubChem CID 87485636) has the molecular formula C39H79NO4S and a molecular weight of 658.13 g/mol. Its IUPAC name is dimethyl-bis[(Z)-octadec-9-enyl]azanium;methyl sulfate.
| Compound Name | dimethyl-bis[(Z)-octadec-9-enyl]azanium;methyl sulfate |
|---|---|
| PubChem CID | 87485636 |
| Molecular Formula | C39H79NO4S |
| Molecular Weight | 658.13 g/mol |
| Exact Mass | 657.57 |
| IUPAC Name | dimethyl-bis[(Z)-octadec-9-enyl]azanium;methyl sulfate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC[N+](C)(C)CCCCCCCC/C=C\CCCCCCCC.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C38H76N.CH4O4S/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39(3,4)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2;1-5-6(2,3)4/h19-22H,5-18,23-38H2,1-4H3;1H3,(H,2,3,4)/q+1;/p-1/b21-19-,22-20-; |
| InChIKey | AZGCHDONWDRLJE-JDVCJPALSA-M |
| XLogP | 12.23 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.13 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|