C38H74N+ — CID 88625479
dimethyl-[(9Z,12Z)-octadeca-9,12-dienyl]-[(Z)-octadec-9-enyl]azanium (PubChem CID 88625479) has the molecular formula C38H74N+ and a molecular weight of 545.02 g/mol. Its IUPAC name is dimethyl-[(9Z,12Z)-octadeca-9,12-dienyl]-[(Z)-octadec-9-enyl]azanium.
| Compound Name | dimethyl-[(9Z,12Z)-octadeca-9,12-dienyl]-[(Z)-octadec-9-enyl]azanium |
|---|---|
| PubChem CID | 88625479 |
| Molecular Formula | C38H74N+ |
| Molecular Weight | 545.02 g/mol |
| Exact Mass | 544.58 |
| IUPAC Name | dimethyl-[(9Z,12Z)-octadeca-9,12-dienyl]-[(Z)-octadec-9-enyl]azanium |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC[N+](C)(C)CCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C38H74N/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39(3,4)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13,15,19-22H,5-12,14,16-18,23-38H2,1-4H3/q+1/b15-13-,21-19-,22-20- |
| InChIKey | CLEIKSIAVYRJPS-YVFFZHSKSA-N |
| XLogP | 12.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 31 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.02 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|