C21H42ClN — CID 71587378
trimethyl-[(9Z,12Z)-octadeca-9,12-dienyl]azanium chloride (PubChem CID 71587378) has the molecular formula C21H42ClN and a molecular weight of 344.03 g/mol. Its IUPAC name is trimethyl-[(9Z,12Z)-octadeca-9,12-dienyl]azanium chloride.
| Compound Name | trimethyl-[(9Z,12Z)-octadeca-9,12-dienyl]azanium chloride |
|---|---|
| PubChem CID | 71587378 |
| Molecular Formula | C21H42ClN |
| Molecular Weight | 344.03 g/mol |
| Exact Mass | 343.30 |
| IUPAC Name | trimethyl-[(9Z,12Z)-octadeca-9,12-dienyl]azanium chloride |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C21H42N.ClH/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(2,3)4;/h9-10,12-13H,5-8,11,14-21H2,1-4H3;1H/q+1;/p-1/b10-9-,13-12-; |
| InChIKey | CWTBMCFZZDVKBG-SCNCTLMVSA-M |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.03 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|