About bis(2-hydroxyethyl(trimethyl)azanium);sulfonatooxy sulfate
bis(2-hydroxyethyl(trimethyl)azanium);sulfonatooxy sulfate (PubChem CID 87575091) has the molecular formula C10H28N2O10S2
and a molecular weight of 400.47 g/mol. Its IUPAC name is bis(2-hydroxyethyl(trimethyl)azanium);sulfonatooxy sulfate.
Molecular Properties
| Compound Name | bis(2-hydroxyethyl(trimethyl)azanium);sulfonatooxy sulfate |
| PubChem CID | 87575091 |
| Molecular Formula | C10H28N2O10S2 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | bis(2-hydroxyethyl(trimethyl)azanium);sulfonatooxy sulfate |
| SMILES | C[N+](C)(C)CCO.C[N+](C)(C)CCO.O=S(=O)([O-])OOS(=O)(=O)[O-] |
| InChI | InChI=1S/2C5H14NO.H2O8S2/c2*1-6(2,3)4-5-7;1-9(2,3)7-8-10(4,5)6/h2*7H,4-5H2,1-3H3;(H,1,2,3)(H,4,5,6)/q2*+1;/p-2 |
| InChIKey | JNYJFSNSDJITEK-UHFFFAOYSA-L |
| XLogP | -2.78 |
| TPSA | 173.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze bis(2-hydroxyethyl(trimethyl)azanium);sulfonatooxy sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-hydroxyethyl(trimethyl)azanium);sulfonatooxy sulfate?
The IUPAC name of bis(2-hydroxyethyl(trimethyl)azanium);sulfonatooxy sulfate (CID 87575091) is bis(2-hydroxyethyl(trimethyl)azanium);sulfonatooxy sulfate.
What is the SMILES notation for bis(2-hydroxyethyl(trimethyl)azanium);sulfonatooxy sulfate?
The canonical SMILES for bis(2-hydroxyethyl(trimethyl)azanium);sulfonatooxy sulfate is C[N+](C)(C)CCO.C[N+](C)(C)CCO.O=S(=O)([O-])OOS(=O)(=O)[O-].
What is the InChIKey of bis(2-hydroxyethyl(trimethyl)azanium);sulfonatooxy sulfate?
The InChIKey is JNYJFSNSDJITEK-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H14NO.H2O8S2/c2*1-6(2,3)4-5-7;1-9(2,3)7-8-10(4,5)6/h2*7H,4-5H2,1-3H3;(H,1,2,3)(H,4,5,6)/q2*+1;/p-2.
What are the key properties of bis(2-hydroxyethyl(trimethyl)azanium);sulfonatooxy sulfate?
bis(2-hydroxyethyl(trimethyl)azanium);sulfonatooxy sulfate has a molecular weight of 400.47 g/mol, XLogP of -2.78, 7 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-hydroxyethyl(trimethyl)azanium);sulfonatooxy sulfate is sourced from PubChem (CID 87575091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).