C10H28N2O6Se — CID 86566768
bis(2-hydroxyethyl(trimethyl)azanium);selenate (PubChem CID 86566768) has the molecular formula C10H28N2O6Se and a molecular weight of 351.30 g/mol. Its IUPAC name is bis(2-hydroxyethyl(trimethyl)azanium);selenate.
| Compound Name | bis(2-hydroxyethyl(trimethyl)azanium);selenate |
|---|---|
| PubChem CID | 86566768 |
| Molecular Formula | C10H28N2O6Se |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | bis(2-hydroxyethyl(trimethyl)azanium);selenate |
| SMILES | C[N+](C)(C)CCO.C[N+](C)(C)CCO.O=[Se](=O)([O-])[O-] |
| InChI | InChI=1S/2C5H14NO.H2O4Se/c2*1-6(2,3)4-5-7;1-5(2,3)4/h2*7H,4-5H2,1-3H3;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | TXVSIUGTSVIKGB-UHFFFAOYSA-L |
| XLogP | -3.63 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|