C13H19NO5S3 — CID 175921455
ethyl-(2-hydroxyethyl)-dithiophen-2-ylazanium;methyl sulfate (PubChem CID 175921455) has the molecular formula C13H19NO5S3 and a molecular weight of 365.50 g/mol. Its IUPAC name is ethyl-(2-hydroxyethyl)-dithiophen-2-ylazanium;methyl sulfate.
| Compound Name | ethyl-(2-hydroxyethyl)-dithiophen-2-ylazanium;methyl sulfate |
|---|---|
| PubChem CID | 175921455 |
| Molecular Formula | C13H19NO5S3 |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | ethyl-(2-hydroxyethyl)-dithiophen-2-ylazanium;methyl sulfate |
| SMILES | CC[N+](CCO)(c1cccs1)c1cccs1.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H16NOS2.CH4O4S/c1-2-13(7-8-14,11-5-3-9-15-11)12-6-4-10-16-12;1-5-6(2,3)4/h3-6,9-10,14H,2,7-8H2,1H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | VHYVFXVEVDSIKR-UHFFFAOYSA-M |
| XLogP | 2.55 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|