About tetrabutylazanium;thiophene-2-sulfonate
tetrabutylazanium;thiophene-2-sulfonate (PubChem CID 141065948) has the molecular formula C20H39NO3S2
and a molecular weight of 405.67 g/mol. Its IUPAC name is tetrabutylazanium;thiophene-2-sulfonate.
Molecular Properties
| Compound Name | tetrabutylazanium;thiophene-2-sulfonate |
| PubChem CID | 141065948 |
| Molecular Formula | C20H39NO3S2 |
| Molecular Weight | 405.67 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | tetrabutylazanium;thiophene-2-sulfonate |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)([O-])c1cccs1 |
| InChI | InChI=1S/C16H36N.C4H4O3S2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;5-9(6,7)4-2-1-3-8-4/h5-16H2,1-4H3;1-3H,(H,5,6,7)/q+1;/p-1 |
| InChIKey | NHXCNZNZRHIPBK-UHFFFAOYSA-M |
| XLogP | 5.66 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.67 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze tetrabutylazanium;thiophene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylazanium;thiophene-2-sulfonate?
The IUPAC name of tetrabutylazanium;thiophene-2-sulfonate (CID 141065948) is tetrabutylazanium;thiophene-2-sulfonate.
What is the SMILES notation for tetrabutylazanium;thiophene-2-sulfonate?
The canonical SMILES for tetrabutylazanium;thiophene-2-sulfonate is CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)([O-])c1cccs1.
What is the InChIKey of tetrabutylazanium;thiophene-2-sulfonate?
The InChIKey is NHXCNZNZRHIPBK-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C4H4O3S2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;5-9(6,7)4-2-1-3-8-4/h5-16H2,1-4H3;1-3H,(H,5,6,7)/q+1;/p-1.
What are the key properties of tetrabutylazanium;thiophene-2-sulfonate?
tetrabutylazanium;thiophene-2-sulfonate has a molecular weight of 405.67 g/mol, XLogP of 5.66, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylazanium;thiophene-2-sulfonate is sourced from PubChem (CID 141065948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).