C23H40F3NO3S — CID 87416588
tetrabutylazanium;3-(trifluoromethyl)benzenesulfonate (PubChem CID 87416588) has the molecular formula C23H40F3NO3S and a molecular weight of 467.64 g/mol. Its IUPAC name is tetrabutylazanium;3-(trifluoromethyl)benzenesulfonate.
| Compound Name | tetrabutylazanium;3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 87416588 |
| Molecular Formula | C23H40F3NO3S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | tetrabutylazanium;3-(trifluoromethyl)benzenesulfonate |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)([O-])c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H36N.C7H5F3O3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;8-7(9,10)5-2-1-3-6(4-5)14(11,12)13/h5-16H2,1-4H3;1-4H,(H,11,12,13)/q+1;/p-1 |
| InChIKey | ZWKOTCPSQYMGGO-UHFFFAOYSA-M |
| XLogP | 6.61 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|