C43H61BF9N — CID 87203345
hexyl-tris[3-(trifluoromethyl)phenyl]boranuide;tetrabutylazanium (PubChem CID 87203345) has the molecular formula C43H61BF9N and a molecular weight of 773.76 g/mol. Its IUPAC name is hexyl-tris[3-(trifluoromethyl)phenyl]boranuide;tetrabutylazanium.
| Compound Name | hexyl-tris[3-(trifluoromethyl)phenyl]boranuide;tetrabutylazanium |
|---|---|
| PubChem CID | 87203345 |
| Molecular Formula | C43H61BF9N |
| Molecular Weight | 773.76 g/mol |
| Exact Mass | 773.48 |
| IUPAC Name | hexyl-tris[3-(trifluoromethyl)phenyl]boranuide;tetrabutylazanium |
| SMILES | CCCCCC[B-](c1cccc(C(F)(F)F)c1)(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1.CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C27H25BF9.C16H36N/c1-2-3-4-5-15-28(22-12-6-9-19(16-22)25(29,30)31,23-13-7-10-20(17-23)26(32,33)34)24-14-8-11-21(18-24)27(35,36)37;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h6-14,16-18H,2-5,15H2,1H3;5-16H2,1-4H3/q-1;+1 |
| InChIKey | WCDRMZZBVJEBQN-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.76 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|