C24H22BF6- — CID 18518851
tris(3,5-difluorophenyl)-hexylboranuide (PubChem CID 18518851) has the molecular formula C24H22BF6- and a molecular weight of 435.24 g/mol. Its IUPAC name is tris(3,5-difluorophenyl)-hexylboranuide.
| Compound Name | tris(3,5-difluorophenyl)-hexylboranuide |
|---|---|
| PubChem CID | 18518851 |
| Molecular Formula | C24H22BF6- |
| Molecular Weight | 435.24 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | tris(3,5-difluorophenyl)-hexylboranuide |
| SMILES | CCCCCC[B-](c1cc(F)cc(F)c1)(c1cc(F)cc(F)c1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C24H22BF6/c1-2-3-4-5-6-25(16-7-19(26)13-20(27)8-16,17-9-21(28)14-22(29)10-17)18-11-23(30)15-24(31)12-18/h7-15H,2-6H2,1H3/q-1 |
| InChIKey | IQJJTGIEBGRZOT-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.24 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|