About tetrabutylazanium;tris(4-methoxyphenyl)-pentylboranuide
tetrabutylazanium;tris(4-methoxyphenyl)-pentylboranuide (PubChem CID 23284024) has the molecular formula C42H68BNO3
and a molecular weight of 645.82 g/mol. Its IUPAC name is tetrabutylazanium;tris(4-methoxyphenyl)-pentylboranuide.
Molecular Properties
| Compound Name | tetrabutylazanium;tris(4-methoxyphenyl)-pentylboranuide |
| PubChem CID | 23284024 |
| Molecular Formula | C42H68BNO3 |
| Molecular Weight | 645.82 g/mol |
| Exact Mass | 645.53 |
| IUPAC Name | tetrabutylazanium;tris(4-methoxyphenyl)-pentylboranuide |
| SMILES | CCCCC[B-](c1ccc(OC)cc1)(c1ccc(OC)cc1)c1ccc(OC)cc1.CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C26H32BO3.C16H36N/c1-5-6-7-20-27(21-8-14-24(28-2)15-9-21,22-10-16-25(29-3)17-11-22)23-12-18-26(30-4)19-13-23;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h8-19H,5-7,20H2,1-4H3;5-16H2,1-4H3/q-1;+1 |
| InChIKey | KZYBUHASZOFOQX-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 645.82 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetrabutylazanium;tris(4-methoxyphenyl)-pentylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylazanium;tris(4-methoxyphenyl)-pentylboranuide?
The IUPAC name of tetrabutylazanium;tris(4-methoxyphenyl)-pentylboranuide (CID 23284024) is tetrabutylazanium;tris(4-methoxyphenyl)-pentylboranuide.
What is the SMILES notation for tetrabutylazanium;tris(4-methoxyphenyl)-pentylboranuide?
The canonical SMILES for tetrabutylazanium;tris(4-methoxyphenyl)-pentylboranuide is CCCCC[B-](c1ccc(OC)cc1)(c1ccc(OC)cc1)c1ccc(OC)cc1.CCCC[N+](CCCC)(CCCC)CCCC.
What is the InChIKey of tetrabutylazanium;tris(4-methoxyphenyl)-pentylboranuide?
The InChIKey is KZYBUHASZOFOQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32BO3.C16H36N/c1-5-6-7-20-27(21-8-14-24(28-2)15-9-21,22-10-16-25(29-3)17-11-22)23-12-18-26(30-4)19-13-23;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h8-19H,5-7,20H2,1-4H3;5-16H2,1-4H3/q-1;+1.
What are the key properties of tetrabutylazanium;tris(4-methoxyphenyl)-pentylboranuide?
tetrabutylazanium;tris(4-methoxyphenyl)-pentylboranuide has a molecular weight of 645.82 g/mol, XLogP of 9.38, 22 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylazanium;tris(4-methoxyphenyl)-pentylboranuide is sourced from PubChem (CID 23284024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).