About tetrabutylazanium;trifluoro-(6-methoxy-3-pyridinyl)boranuide
tetrabutylazanium;trifluoro-(6-methoxy-3-pyridinyl)boranuide (PubChem CID 91641350) has the molecular formula C22H42BF3N2O
and a molecular weight of 418.40 g/mol. Its IUPAC name is tetrabutylazanium;trifluoro-(6-methoxy-3-pyridinyl)boranuide.
Molecular Properties
| Compound Name | tetrabutylazanium;trifluoro-(6-methoxy-3-pyridinyl)boranuide |
| PubChem CID | 91641350 |
| Molecular Formula | C22H42BF3N2O |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | tetrabutylazanium;trifluoro-(6-methoxy-3-pyridinyl)boranuide |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.COc1ccc([B-](F)(F)F)cn1 |
| InChI | InChI=1S/C16H36N.C6H6BF3NO/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-12-6-3-2-5(4-11-6)7(8,9)10/h5-16H2,1-4H3;2-4H,1H3/q+1;-1 |
| InChIKey | XMVAHVZVVHNYBJ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetrabutylazanium;trifluoro-(6-methoxy-3-pyridinyl)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylazanium;trifluoro-(6-methoxy-3-pyridinyl)boranuide?
The IUPAC name of tetrabutylazanium;trifluoro-(6-methoxy-3-pyridinyl)boranuide (CID 91641350) is tetrabutylazanium;trifluoro-(6-methoxy-3-pyridinyl)boranuide.
What is the SMILES notation for tetrabutylazanium;trifluoro-(6-methoxy-3-pyridinyl)boranuide?
The canonical SMILES for tetrabutylazanium;trifluoro-(6-methoxy-3-pyridinyl)boranuide is CCCC[N+](CCCC)(CCCC)CCCC.COc1ccc([B-](F)(F)F)cn1.
What is the InChIKey of tetrabutylazanium;trifluoro-(6-methoxy-3-pyridinyl)boranuide?
The InChIKey is XMVAHVZVVHNYBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.C6H6BF3NO/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-12-6-3-2-5(4-11-6)7(8,9)10/h5-16H2,1-4H3;2-4H,1H3/q+1;-1.
What are the key properties of tetrabutylazanium;trifluoro-(6-methoxy-3-pyridinyl)boranuide?
tetrabutylazanium;trifluoro-(6-methoxy-3-pyridinyl)boranuide has a molecular weight of 418.40 g/mol, XLogP of 6.15, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylazanium;trifluoro-(6-methoxy-3-pyridinyl)boranuide is sourced from PubChem (CID 91641350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).