About 2-ethynyl-4-methoxypyrimidine;tetrabutylazanium;fluoride
2-ethynyl-4-methoxypyrimidine;tetrabutylazanium;fluoride (PubChem CID 161052274) has the molecular formula C23H42FN3O
and a molecular weight of 395.61 g/mol. Its IUPAC name is 2-ethynyl-4-methoxypyrimidine;tetrabutylazanium;fluoride.
Molecular Properties
| Compound Name | 2-ethynyl-4-methoxypyrimidine;tetrabutylazanium;fluoride |
| PubChem CID | 161052274 |
| Molecular Formula | C23H42FN3O |
| Molecular Weight | 395.61 g/mol |
| Exact Mass | 395.33 |
| IUPAC Name | 2-ethynyl-4-methoxypyrimidine;tetrabutylazanium;fluoride |
| SMILES | C#Cc1nccc(OC)n1.CCCC[N+](CCCC)(CCCC)CCCC.[F-] |
| InChI | InChI=1S/C16H36N.C7H6N2O.FH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-3-6-8-5-4-7(9-6)10-2;/h5-16H2,1-4H3;1,4-5H,2H3;1H/q+1;;/p-1 |
| InChIKey | UCHHEIQGLBTGSD-UHFFFAOYSA-M |
| XLogP | 2.47 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.61 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynyl-4-methoxypyrimidine;tetrabutylazanium;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynyl-4-methoxypyrimidine;tetrabutylazanium;fluoride?
The IUPAC name of 2-ethynyl-4-methoxypyrimidine;tetrabutylazanium;fluoride (CID 161052274) is 2-ethynyl-4-methoxypyrimidine;tetrabutylazanium;fluoride.
What is the SMILES notation for 2-ethynyl-4-methoxypyrimidine;tetrabutylazanium;fluoride?
The canonical SMILES for 2-ethynyl-4-methoxypyrimidine;tetrabutylazanium;fluoride is C#Cc1nccc(OC)n1.CCCC[N+](CCCC)(CCCC)CCCC.[F-].
What is the InChIKey of 2-ethynyl-4-methoxypyrimidine;tetrabutylazanium;fluoride?
The InChIKey is UCHHEIQGLBTGSD-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C7H6N2O.FH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-3-6-8-5-4-7(9-6)10-2;/h5-16H2,1-4H3;1,4-5H,2H3;1H/q+1;;/p-1.
What are the key properties of 2-ethynyl-4-methoxypyrimidine;tetrabutylazanium;fluoride?
2-ethynyl-4-methoxypyrimidine;tetrabutylazanium;fluoride has a molecular weight of 395.61 g/mol, XLogP of 2.47, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynyl-4-methoxypyrimidine;tetrabutylazanium;fluoride is sourced from PubChem (CID 161052274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).