C25H46NO3+ — CID 87876090
2,2-dimethylpropanoic acid;tributyl-[(4-methoxyphenyl)methyl]azanium (PubChem CID 87876090) has the molecular formula C25H46NO3+ and a molecular weight of 408.65 g/mol. Its IUPAC name is 2,2-dimethylpropanoic acid;tributyl-[(4-methoxyphenyl)methyl]azanium.
| Compound Name | 2,2-dimethylpropanoic acid;tributyl-[(4-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 87876090 |
| Molecular Formula | C25H46NO3+ |
| Molecular Weight | 408.65 g/mol |
| Exact Mass | 408.35 |
| IUPAC Name | 2,2-dimethylpropanoic acid;tributyl-[(4-methoxyphenyl)methyl]azanium |
| SMILES | CC(C)(C)C(=O)O.CCCC[N+](CCCC)(CCCC)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H36NO.C5H10O2/c1-5-8-15-21(16-9-6-2,17-10-7-3)18-19-11-13-20(22-4)14-12-19;1-5(2,3)4(6)7/h11-14H,5-10,15-18H2,1-4H3;1-3H3,(H,6,7)/q+1; |
| InChIKey | MOYOOFATMSXWQO-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.65 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|