C44H43BF9N — CID 87203290
hexyl-tris[3-(trifluoromethyl)phenyl]boranuide;[2-[(2Z,4E)-5-phenylpenta-2,4-dien-2-yl]phenyl]azanium (PubChem CID 87203290) has the molecular formula C44H43BF9N and a molecular weight of 767.63 g/mol. Its IUPAC name is hexyl-tris[3-(trifluoromethyl)phenyl]boranuide;[2-[(2Z,4E)-5-phenylpenta-2,4-dien-2-yl]phenyl]azanium.
| Compound Name | hexyl-tris[3-(trifluoromethyl)phenyl]boranuide;[2-[(2Z,4E)-5-phenylpenta-2,4-dien-2-yl]phenyl]azanium |
|---|---|
| PubChem CID | 87203290 |
| Molecular Formula | C44H43BF9N |
| Molecular Weight | 767.63 g/mol |
| Exact Mass | 767.33 |
| IUPAC Name | hexyl-tris[3-(trifluoromethyl)phenyl]boranuide;[2-[(2Z,4E)-5-phenylpenta-2,4-dien-2-yl]phenyl]azanium |
| SMILES | C/C(=C/C=C/c1ccccc1)c1ccccc1[NH3+].CCCCCC[B-](c1cccc(C(F)(F)F)c1)(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H25BF9.C17H17N/c1-2-3-4-5-15-28(22-12-6-9-19(16-22)25(29,30)31,23-13-7-10-20(17-23)26(32,33)34)24-14-8-11-21(18-24)27(35,36)37;1-14(16-12-5-6-13-17(16)18)8-7-11-15-9-3-2-4-10-15/h6-14,16-18H,2-5,15H2,1H3;2-13H,18H2,1H3/q-1;/p+1/b;11-7+,14-8- |
| InChIKey | YUQRPSWUZDKSDQ-CSBWGKMUSA-O |
| XLogP | 11.47 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.63 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|