C15H20 — CID 13273746
[(1E,3E)-4-methylocta-1,3-dienyl]benzene (PubChem CID 13273746) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is [(1E,3E)-4-methylocta-1,3-dienyl]benzene.
| Compound Name | [(1E,3E)-4-methylocta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 13273746 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | [(1E,3E)-4-methylocta-1,3-dienyl]benzene |
| SMILES | CCCC/C(C)=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H20/c1-3-4-9-14(2)10-8-13-15-11-6-5-7-12-15/h5-8,10-13H,3-4,9H2,1-2H3/b13-8+,14-10+ |
| InChIKey | AZJREJSHNFNACF-WCKMZMOMSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|