C23H38Sn — CID 11212663
tributyl-[(2E,4Z)-5-phenylpenta-2,4-dien-2-yl]stannane (PubChem CID 11212663) has the molecular formula C23H38Sn and a molecular weight of 433.27 g/mol. Its IUPAC name is tributyl-[(2E,4Z)-5-phenylpenta-2,4-dien-2-yl]stannane.
| Compound Name | tributyl-[(2E,4Z)-5-phenylpenta-2,4-dien-2-yl]stannane |
|---|---|
| PubChem CID | 11212663 |
| Molecular Formula | C23H38Sn |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | tributyl-[(2E,4Z)-5-phenylpenta-2,4-dien-2-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(C)=C/C=C\c1ccccc1 |
| InChI | InChI=1S/C11H11.3C4H9.Sn/c1-2-3-5-8-11-9-6-4-7-10-11;3*1-3-4-2;/h3-10H,1H3;3*1,3-4H2,2H3;/b3-2?,8-5-;;;; |
| InChIKey | QILKBYAYZUADTE-NSEWNGHDSA-N |
| XLogP | 8.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|