C12H13Cl — CID 79323612
(5-chloro-4-methylpenta-1,3-dienyl)benzene (PubChem CID 79323612) has the molecular formula C12H13Cl and a molecular weight of 192.69 g/mol. Its IUPAC name is (5-chloro-4-methylpenta-1,3-dienyl)benzene.
| Compound Name | (5-chloro-4-methylpenta-1,3-dienyl)benzene |
|---|---|
| PubChem CID | 79323612 |
| Molecular Formula | C12H13Cl |
| Molecular Weight | 192.69 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | (5-chloro-4-methylpenta-1,3-dienyl)benzene |
| SMILES | CC(=CC=Cc1ccccc1)CCl |
| InChI | InChI=1S/C12H13Cl/c1-11(10-13)6-5-9-12-7-3-2-4-8-12/h2-9H,10H2,1H3 |
| InChIKey | QTCLAPPJDAHYEK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.69 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|