C18H17ClO2S — CID 73060329
1-[5-(benzenesulfonyl)-4-methylpenta-1,3-dienyl]-4-chlorobenzene (PubChem CID 73060329) has the molecular formula C18H17ClO2S and a molecular weight of 332.85 g/mol. Its IUPAC name is 1-[5-(benzenesulfonyl)-4-methylpenta-1,3-dienyl]-4-chlorobenzene.
| Compound Name | 1-[5-(benzenesulfonyl)-4-methylpenta-1,3-dienyl]-4-chlorobenzene |
|---|---|
| PubChem CID | 73060329 |
| Molecular Formula | C18H17ClO2S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 1-[5-(benzenesulfonyl)-4-methylpenta-1,3-dienyl]-4-chlorobenzene |
| SMILES | CC(=CC=Cc1ccc(Cl)cc1)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17ClO2S/c1-15(6-5-7-16-10-12-17(19)13-11-16)14-22(20,21)18-8-3-2-4-9-18/h2-13H,14H2,1H3 |
| InChIKey | NDNJXVWIRCRDBS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|