C19H20O3S — CID 73028468
1-[5-(benzenesulfonyl)-4-methylpenta-1,3-dienyl]-4-methoxybenzene (PubChem CID 73028468) has the molecular formula C19H20O3S and a molecular weight of 328.43 g/mol. Its IUPAC name is 1-[5-(benzenesulfonyl)-4-methylpenta-1,3-dienyl]-4-methoxybenzene.
| Compound Name | 1-[5-(benzenesulfonyl)-4-methylpenta-1,3-dienyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 73028468 |
| Molecular Formula | C19H20O3S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-[5-(benzenesulfonyl)-4-methylpenta-1,3-dienyl]-4-methoxybenzene |
| SMILES | COc1ccc(C=CC=C(C)CS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20O3S/c1-16(15-23(20,21)19-9-4-3-5-10-19)7-6-8-17-11-13-18(22-2)14-12-17/h3-14H,15H2,1-2H3 |
| InChIKey | CYQNYUOKMZPXFK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|